|
|
Sell: Sell Allyl caproate |
| Date: |
2008-11-14 |
| Cas#: |
123-68-2 |
| Specification: |
|
| Price: |
|
| Quantity: |
100000Ton |
| Term: |
365 |
| Note: |
Allyl caproate
Chemical Name:Allyl caproate
Molecular Formula: C9H16O2
Structural Formula:CH3(CH2)COOCH2CH=CH2
Molecular Weight:156.22
CAS-NO.: 123-68-2
Appearance (20oC): Colorless to yellow clear liquid.
Content: 99.0PCT MIN (Chromatographic Detection)
Specific Gravity(25/25oC): 0.884-0.890
Refractive Index(20oC):1.422-1.426
Acid Number(KOH mg/g): 1 Max
Allyl Alcohol Content: 0.10PCT MAX (Chromatographic Detection)
Flash Point: 74 oC
Condition of Storage: Shady and cool, completely sealed in the container.
Shelf Life: At least one year
Packing: 170 kg/drum
Solubility (20oC):1.2-propylene glycol 1:5v/v
Use:Used for producing essence and spice. |
|
|
