| Sell. 4-bromo-3-chloroaniline2021-05-08 |
Molecular formula:C6H5BrClN Molecular weight:206.4676 |
Company: Shanghai jonell pharmatech co.,ltd. [Tel:0086-19542788059] |
|
| Sell. methyl 4-acetyl-3-chlorobenzoate2021-05-08 |
Molecular formula:C10H9O3Cl Molecular weight:212.62966 |
Company: Shanghai jonell pharmatech co.,ltd. [Tel:0086-19542788059] |
|
| Sell. tert-butyl N-(2-amino-4-fluoro-phenyl)carbamate2021-05-08 |
Molecular formula:C11H15FN2O2 Molecular weight:226.25 |
Company: Shanghai jonell pharmatech co.,ltd. [Tel:0086-19542788059] |
|
| Sell. N-methyl-4-hydroxypiperidine2021-05-08 |
Molecular formula:C6H13NO Molecular weight:115.17 |
Company: Shanghai jonell pharmatech co.,ltd. [Tel:0086-19542788059] |
|
| Sell. 2-(3-chlorophenyl)isonicotinic acid2021-05-08 |
Molecular formula:C12H8ClNO2 Molecular weight:233.65 |
Company: Shanghai jonell pharmatech co.,ltd. [Tel:0086-19542788059] |
|
| Sell. 6-hydroxy-2-methylpyridine2021-05-08 |
Molecular formula:C6H7NO Molecular weight:109.13 |
Company: Shanghai jonell pharmatech co.,ltd. [Tel:0086-19542788059] |
|
| Sell. (+)-cis-(1S,3R)-3-carbomethoxycyclopentane carboxylic acid2021-05-08 |
Molecular formula:C8H12O4 Molecular weight:172.18 |
Company: Shanghai jonell pharmatech co.,ltd. [Tel:0086-19542788059] |
|
| Sell. 3-methylenecyclobutane-1-carboxylic acid2021-05-08 |
Molecular formula:C6H8O2 Molecular weight:112.13 |
Company: Shanghai jonell pharmatech co.,ltd. [Tel:0086-19542788059] |
|
| Sell. 3-methylenecyclobutanecarboxylic acid2021-05-08 |
Molecular formula:C6H8O2 Molecular weight:112.13 |
Company: Shanghai jonell pharmatech co.,ltd. [Tel:0086-19542788059] |
|
| Sell. 3-fluoro(pyridin-2-yl)carboxylic acid2021-05-08 |
Molecular formula:C6H4FNO2 Molecular weight:141.10 |
Company: Shanghai jonell pharmatech co.,ltd. [Tel:0086-19542788059] |
|
| Sell. 4-fluoro-6-bromo-1H-indazole2021-05-08 |
Molecular formula:C7H4BrFN2 Molecular weight:215.0225 |
Company: Shanghai jonell pharmatech co.,ltd. [Tel:0086-19542788059] |
|
| Sell. 6-bromo-3-fluoro-2-formylpyridine2021-05-08 |
Molecular formula:C6H3BrFNO Molecular weight:203.9965 |
Company: Shanghai jonell pharmatech co.,ltd. [Tel:0086-19542788059] |
|
| Sell. (1-methylindol-5-yl)boronic acid2021-05-08 |
|
Company: Shanghai jonell pharmatech co.,ltd. [Tel:0086-19542788059] |
|
| Sell. 2-Chloro-4-iodo-3-pyridinecarboxaldehyde2021-05-08 |
Molecular formula:C6H3ClINO Molecular weight:267.45 |
Company: Shanghai jonell pharmatech co.,ltd. [Tel:0086-19542788059] |
|
| Sell. methyl 5-bromopicolinate2021-05-08 |
Molecular formula:C7H6BrNO2 Molecular weight:216.03 |
Company: Shanghai jonell pharmatech co.,ltd. [Tel:0086-19542788059] |
|
| Sell. 8-chloro-1,7-naphthyridine2021-05-08 |
Molecular formula:C8H5ClN2 Molecular weight:164.59 |
Company: Shanghai jonell pharmatech co.,ltd. [Tel:0086-19542788059] |
|
| Sell. ClC1=C(OC)C=CC(C(O)=O)=N12021-05-08 |
Molecular formula:C7H6ClNO3 Molecular weight:187.5804 |
Company: Shanghai jonell pharmatech co.,ltd. [Tel:0086-19542788059] |
|
| Sell. 6-bromo-isoquinoline2021-05-08 |
Molecular formula:C9H6BrN Molecular weight:208.05 |
Company: Shanghai jonell pharmatech co.,ltd. [Tel:0086-19542788059] |
|
| Sell. 1-isopropyl-4,6-dihydrospiro[indazole-5,4-piperidin]-7(1H)-one hydrochloride salt2021-05-08 |
|
Company: Shanghai jonell pharmatech co.,ltd. [Tel:0086-19542788059] |
|
| Sell. 2-methoxy-6-(naphthalen-2-yl)pyridine2021-05-08 |
|
Company: Shanghai jonell pharmatech co.,ltd. [Tel:0086-19542788059] |
|