| Sell. Fmoc-Orn(Fmoc)-OH2016-03-11 |
Molecular formula:C35H32N2O6
Molecular weight: |
Company: GL Biochem (Shanghai) Ltd. [Tel:021-61263311] |
|
| Sell. Boc-Trp-OL2016-03-11 |
Molecular formula:C16H22N2O3
Molecular weight:290.36 |
Company: GL Biochem (Shanghai) Ltd. [Tel:021-61263311] |
|
| Sell. Boc-D-Phe-OL2016-03-11 |
Molecular formula:C14H21NO3
Molecular weight:251.32 |
Company: GL Biochem (Shanghai) Ltd. [Tel:021-61263311] |
|
| Sell. Fmoc-Gly-Gly-OH2016-03-11 |
Molecular formula:C19H18N2O5
Molecular weight:354.36 |
Company: GL Biochem (Shanghai) Ltd. [Tel:021-61263311] |
|
| Sell. Mpa(Trt)-OH2016-03-11 |
Molecular formula:C22H20O2S
Molecular weight:348.46 |
Company: GL Biochem (Shanghai) Ltd. [Tel:021-61263311] |
|
| Sell. H-5-Ava-OH2016-03-11 |
Molecular formula:C5H11NO2
Molecular weight:117.15 |
Company: GL Biochem (Shanghai) Ltd. [Tel:021-61263311] |
|
| Sell. Fmoc-OSu, 99% min.2016-03-11 |
Molecular formula:C19H15NO5
Molecular weight:337.33 |
Company: GL Biochem (Shanghai) Ltd. [Tel:021-61263311] |
|
| Sell. DMT-Cl, 98% min.2016-03-11 |
Molecular formula:C21H19ClO2
Molecular weight:338.83 |
Company: GL Biochem (Shanghai) Ltd. [Tel:021-61263311] |
|
| Sell. HBTU, 99% min.2016-03-11 |
Molecular formula:C11H16N5O.PF6;C11H16F6N5OP
Molecular weight:379.24 |
Company: GL Biochem (Shanghai) Ltd. [Tel:021-61263311] |
|
| Sell. TBTU, 99% min.2016-03-11 |
Molecular formula:C11H16N5O.BF4
Molecular weight:321.08 |
Company: GL Biochem (Shanghai) Ltd. [Tel:021-61263311] |
|
| Sell. HCTU2016-03-11 |
Molecular formula:C11H15ClF6N5OP
Molecular weight:413.69 |
Company: GL Biochem (Shanghai) Ltd. [Tel:021-61263311] |
|
| Sell. PyBOP, 99% min.2016-03-11 |
Molecular formula:C18H28F6N6OP2
Molecular weight:520.40 |
Company: GL Biochem (Shanghai) Ltd. [Tel:021-61263311] |
|
| Sell. EDC隆陇HCl, 98.5% min.2016-03-11 |
Molecular formula:C8H17N3.HCl;C8H18ClN3
Molecular weight:191.70 |
Company: GL Biochem (Shanghai) Ltd. [Tel:021-61263311] |
|
| Sell. Rink Amide Linker, 99% min.2016-03-11 |
Molecular formula:C32H29NO7
Molecular weight:539.58 |
Company: GL Biochem (Shanghai) Ltd. [Tel:021-61263311] |
|
| Sell. Ramage Linker2016-03-11 |
Molecular formula:C32H27NO5
Molecular weight:505.56 |
Company: GL Biochem (Shanghai) Ltd. [Tel:021-61263311] |
|
| Sell. HMBA Linker2016-03-11 |
Molecular formula:C8H8O3
Molecular weight:152.15 |
Company: GL Biochem (Shanghai) Ltd. [Tel:021-61263311] |
|
| Sell. Pure natural improving immunity ganoderma/reishi mushroom extract2016-03-02 |
| Reishi Mushroom Extract / Ganoderma Extract
Boost the immune system; reduce blood pressure
Reishi Mushroom |
Company: World-way biotech inc. [Tel:86 731 84686489] |
|
| Sell. Natural balancing blood sugar, anti-oxidant sorghum extract2016-03-02 |
| Magnolia Bark Extract
Reduce stress and stress-related symptoms and inhibit cortisol
Magnolia Bark Extr |
Company: World-way biotech inc. [Tel:86 731 84686489] |
|
| Sell. Pure natural improving immunity chicoric acid Echinacea purpurea extract2016-03-02 |
| Echinacea Purpurea Extract
Boost immune system, prevent colds
Echinacea Purpurea Extract is extracted fr |
Company: World-way biotech inc. [Tel:86 731 84686489] |
|
| Sell. Natural reducing stress, anti-oxidant magnolia bark extract2016-03-02 |
| Magnolia Bark Extract
Reduce stress and stress-related symptoms and inhibit cortisol
Magnolia Bark Extr |
Company: World-way biotech inc. [Tel:86 731 84686489] |
|
